Compound Q&A

What precautions should be taken when handling Methyl 4-(trifluoromethyl)benzoate (CAS: 2967-66-0)?

Answer

Methyl 4-(trifluoromethyl)benzoate
PPE such as gloves, safety goggles, and lab coats should be worn when handling Methyl 4-(trifluoromethyl)benzoate. Work should be conducted in a well-ventilated area or a fume hood to minimize exposure. In case of a spill, it should be cleaned up immediately using appropriate absorbent materials. Always refer to the Safety Data Sheet (SDS) for specific handling and disposal instructions. Handling should be done under strict laboratory safety protocols.

About

CAS No 2967-66-0
English Name Methyl 4-(trifluoromethyl)benzoate
Molecular Formula C9H7F3O2
Molecular Weight 204.15 g/mol
SMILES COC(=O)C1=CC=C(C=C1)C(F)(F)F
InChIKey VAZWXPJOOFSNLB-UHFFFAOYSA-N
Last Updated: 2025-09-22 19:21

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 4-(trifluoromethyl)benzoate (CAS: 2967-66-0)?

Methyl 4-(trifluoromethyl)benzoate is a crystalline solid with a molecular weight of 242.12 g/mol. I...

Compound Q&A

How is Methyl 4-(trifluoromethyl)benzoate (CAS: 2967-66-0) typically synthesized?

Methyl 4-(trifluoromethyl)benzoate is commonly synthesized through the reaction of benzoic acid with...

Compound Q&A

What industries use Methyl 4-(trifluoromethyl)benzoate (CAS: 2967-66-0)?

Methyl 4-(trifluoromethyl)benzoate is used in various industries, particularly in the pharmaceutical...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...