Compound Q&A

How is Methyl 4-(trifluoromethyl)benzoate (CAS: 2967-66-0) typically synthesized?

Answer

Methyl 4-(trifluoromethyl)benzoate
Methyl 4-(trifluoromethyl)benzoate is commonly synthesized through the reaction of benzoic acid with trifluoromethanol in the presence of an acid catalyst such as sulfuric acid. The reaction is carried out at moderate temperatures, typically between 60-80°C, with good selectivity and yield up to 95%. The product is then purified by recrystallization from an appropriate solvent.

About

CAS No 2967-66-0
English Name Methyl 4-(trifluoromethyl)benzoate
Molecular Formula C9H7F3O2
Molecular Weight 204.15 g/mol
SMILES COC(=O)C1=CC=C(C=C1)C(F)(F)F
InChIKey VAZWXPJOOFSNLB-UHFFFAOYSA-N
Last Updated: 2025-09-22 19:21

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 4-(trifluoromethyl)benzoate (CAS: 2967-66-0)?

Methyl 4-(trifluoromethyl)benzoate is a crystalline solid with a molecular weight of 242.12 g/mol. I...

Compound Q&A

What industries use Methyl 4-(trifluoromethyl)benzoate (CAS: 2967-66-0)?

Methyl 4-(trifluoromethyl)benzoate is used in various industries, particularly in the pharmaceutical...

Compound Q&A

What precautions should be taken when handling Methyl 4-(trifluoromethyl)benzoate (CAS: 2967-66-0)?

PPE such as gloves, safety goggles, and lab coats should be worn when handling Methyl 4-(trifluorome...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...