Compound Q&A

What industries use Methyl 4-(trifluoromethyl)benzoate (CAS: 2967-66-0)?

Answer

Methyl 4-(trifluoromethyl)benzoate
Methyl 4-(trifluoromethyl)benzoate is used in various industries, particularly in the pharmaceutical sector for intermediates in drug synthesis. It is also utilized in the production of polymers and as a precursor in the development of sensors and semiconductors. Its unique chemical structure makes it valuable in these applications due to its stability and functional groups.

About

CAS No 2967-66-0
English Name Methyl 4-(trifluoromethyl)benzoate
Molecular Formula C9H7F3O2
Molecular Weight 204.15 g/mol
SMILES COC(=O)C1=CC=C(C=C1)C(F)(F)F
InChIKey VAZWXPJOOFSNLB-UHFFFAOYSA-N
Last Updated: 2025-09-22 19:21

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 4-(trifluoromethyl)benzoate (CAS: 2967-66-0)?

Methyl 4-(trifluoromethyl)benzoate is a crystalline solid with a molecular weight of 242.12 g/mol. I...

Compound Q&A

How is Methyl 4-(trifluoromethyl)benzoate (CAS: 2967-66-0) typically synthesized?

Methyl 4-(trifluoromethyl)benzoate is commonly synthesized through the reaction of benzoic acid with...

Compound Q&A

What precautions should be taken when handling Methyl 4-(trifluoromethyl)benzoate (CAS: 2967-66-0)?

PPE such as gloves, safety goggles, and lab coats should be worn when handling Methyl 4-(trifluorome...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...