Compound Q&A

What precautions should be taken when handling 1,1,1,3,3,3-Hexaphenyl-3lambda~5~-diphosphaz-2-en-1-ium chloride (CAS: 21050-13-5)?

Answer

1,1,1,3,3,3-Hexaphenyl-3lambda~5~-diphosphaz-2-en-1-ium chloride
When handling 1,1,1,3,3,3-Hexaphenyl-3lambda~5~-diphosphaz-2-en-1-ium chloride (CAS: 21050-13-5), it is essential to use personal protective equipment (PPE) such as gloves, goggles, and a lab coat. The compound should be handled in a well-ventilated area or in a fume hood to minimize exposure. In the event of a spill, the area should be thoroughly cleaned using appropriate procedures outlined in the safety data sheet (SDS).

About

CAS No 21050-13-5
English Name 1,1,1,3,3,3-Hexaphenyl-3lambda~5~-diphosphaz-2-en-1-ium chloride
Molecular Formula C36H30ClNP2
Molecular Weight 574.03 g/mol
SMILES [Cl-].[N+](=P(c1ccccc1)(c2ccccc2)c3ccccc3)=P(c4ccccc4)(c5ccccc5)c6ccccc6
InChIKey LVRCYPYRKNAAMX-UHFFFAOYSA-M
Last Updated: 2025-09-22 19:21

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1,1,1,3,3,3-Hexaphenyl-3lambda~5~-diphosphaz-2-en-1-ium chloride (CAS: 21050-13-5)?

1,1,1,3,3,3-Hexaphenyl-3lambda~5~-diphosphaz-2-en-1-ium chloride (CAS: 21050-13-5) is a crystalline ...

Compound Q&A

How is 1,1,1,3,3,3-Hexaphenyl-3lambda~5~-diphosphaz-2-en-1-ium chloride (CAS: 21050-13-5) typically synthesized?

1,1,1,3,3,3-Hexaphenyl-3lambda~5~-diphosphaz-2-en-1-ium chloride (CAS: 21050-13-5) is typically synt...

Compound Q&A

What industries use 1,1,1,3,3,3-Hexaphenyl-3lambda~5~-diphosphaz-2-en-1-ium chloride (CAS: 21050-13-5)?

1,1,1,3,3,3-Hexaphenyl-3lambda~5~-diphosphaz-2-en-1-ium chloride (CAS: 21050-13-5) has potential app...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...