Compound Q&A

What industries use 1,1,1,3,3,3-Hexaphenyl-3lambda~5~-diphosphaz-2-en-1-ium chloride (CAS: 21050-13-5)?

Answer

1,1,1,3,3,3-Hexaphenyl-3lambda~5~-diphosphaz-2-en-1-ium chloride
1,1,1,3,3,3-Hexaphenyl-3lambda~5~-diphosphaz-2-en-1-ium chloride (CAS: 21050-13-5) has potential applications in pharmaceuticals, where its unique chemical structure may be used in the development of new drug candidates. It may also be used in the synthesis of certain polymers, sensors, and semiconductors due to its electronic properties.

About

CAS No 21050-13-5
English Name 1,1,1,3,3,3-Hexaphenyl-3lambda~5~-diphosphaz-2-en-1-ium chloride
Molecular Formula C36H30ClNP2
Molecular Weight 574.03 g/mol
SMILES [Cl-].[N+](=P(c1ccccc1)(c2ccccc2)c3ccccc3)=P(c4ccccc4)(c5ccccc5)c6ccccc6
InChIKey LVRCYPYRKNAAMX-UHFFFAOYSA-M
Last Updated: 2025-09-22 19:21

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1,1,1,3,3,3-Hexaphenyl-3lambda~5~-diphosphaz-2-en-1-ium chloride (CAS: 21050-13-5)?

1,1,1,3,3,3-Hexaphenyl-3lambda~5~-diphosphaz-2-en-1-ium chloride (CAS: 21050-13-5) is a crystalline ...

Compound Q&A

How is 1,1,1,3,3,3-Hexaphenyl-3lambda~5~-diphosphaz-2-en-1-ium chloride (CAS: 21050-13-5) typically synthesized?

1,1,1,3,3,3-Hexaphenyl-3lambda~5~-diphosphaz-2-en-1-ium chloride (CAS: 21050-13-5) is typically synt...

Compound Q&A

What precautions should be taken when handling 1,1,1,3,3,3-Hexaphenyl-3lambda~5~-diphosphaz-2-en-1-ium chloride (CAS: 21050-13-5)?

When handling 1,1,1,3,3,3-Hexaphenyl-3lambda~5~-diphosphaz-2-en-1-ium chloride (CAS: 21050-13-5), it...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...