Compound Q&A

What are the physical and chemical properties of 1,1,1,3,3,3-Hexaphenyl-3lambda~5~-diphosphaz-2-en-1-ium chloride (CAS: 21050-13-5)?

Answer

1,1,1,3,3,3-Hexaphenyl-3lambda~5~-diphosphaz-2-en-1-ium chloride
1,1,1,3,3,3-Hexaphenyl-3lambda~5~-diphosphaz-2-en-1-ium chloride (CAS: 21050-13-5) is a crystalline compound with a high molecular weight. It is sparingly soluble in common organic solvents but insoluble in water. Its reactivity is relatively low, making it stable under normal conditions. This compound has potential applications in various fields due to its unique chemical structure.

About

CAS No 21050-13-5
English Name 1,1,1,3,3,3-Hexaphenyl-3lambda~5~-diphosphaz-2-en-1-ium chloride
Molecular Formula C36H30ClNP2
Molecular Weight 574.03 g/mol
SMILES [Cl-].[N+](=P(c1ccccc1)(c2ccccc2)c3ccccc3)=P(c4ccccc4)(c5ccccc5)c6ccccc6
InChIKey LVRCYPYRKNAAMX-UHFFFAOYSA-M
Last Updated: 2025-09-22 19:21

Related Q&A

Compound Q&A

How is 1,1,1,3,3,3-Hexaphenyl-3lambda~5~-diphosphaz-2-en-1-ium chloride (CAS: 21050-13-5) typically synthesized?

1,1,1,3,3,3-Hexaphenyl-3lambda~5~-diphosphaz-2-en-1-ium chloride (CAS: 21050-13-5) is typically synt...

Compound Q&A

What industries use 1,1,1,3,3,3-Hexaphenyl-3lambda~5~-diphosphaz-2-en-1-ium chloride (CAS: 21050-13-5)?

1,1,1,3,3,3-Hexaphenyl-3lambda~5~-diphosphaz-2-en-1-ium chloride (CAS: 21050-13-5) has potential app...

Compound Q&A

What precautions should be taken when handling 1,1,1,3,3,3-Hexaphenyl-3lambda~5~-diphosphaz-2-en-1-ium chloride (CAS: 21050-13-5)?

When handling 1,1,1,3,3,3-Hexaphenyl-3lambda~5~-diphosphaz-2-en-1-ium chloride (CAS: 21050-13-5), it...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...