Compound Q&A

How is 3-(4-Nitrophenyl)propanoic acid (CAS: 16642-79-8) typically synthesized?

Answer

3-(4-Nitrophenyl)propanoic acid
3-(4-Nitrophenyl)propanoic acid (CAS: 16642-79-8) is typically synthesized by reacting 4-nitrophenyl chloroformate with propanol in the presence of a base like triethylamine. The reaction yields the desired acid in good yield. The key steps include the formation of the nitrophenyl chloroformate followed by nucleophilic substitution with propanol, leading to the formation of the target compound.

About

CAS No 16642-79-8
English Name 3-(4-Nitrophenyl)propanoic acid
Molecular Formula C9H9NO4
Molecular Weight 195.17 g/mol
SMILES C1=CC(=CC=C1CCC(=O)O)[N+](=O)[O-]
InChIKey VZOPVJNBOQOLPN-UHFFFAOYSA-N
Last Updated: 2025-09-22 19:21

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-(4-Nitrophenyl)propanoic acid (CAS: 16642-79-8)?

3-(4-Nitrophenyl)propanoic acid (CAS: 16642-79-8) is a white crystalline solid with a molecular weig...

Compound Q&A

What industries use 3-(4-Nitrophenyl)propanoic acid (CAS: 16642-79-8)?

3-(4-Nitrophenyl)propanoic acid (CAS: 16642-79-8) is primarily used in the pharmaceutical industry f...

Compound Q&A

What precautions should be taken when handling 3-(4-Nitrophenyl)propanoic acid (CAS: 16642-79-8)?

When handling 3-(4-Nitrophenyl)propanoic acid (CAS: 16642-79-8), it is important to wear appropriate...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...