Compound Q&A

What are the physical and chemical properties of 3-(4-Nitrophenyl)propanoic acid (CAS: 16642-79-8)?

Answer

3-(4-Nitrophenyl)propanoic acid
3-(4-Nitrophenyl)propanoic acid (CAS: 16642-79-8) is a white crystalline solid with a molecular weight of approximately 210.14 g/mol. It is sparingly soluble in water and has good solubility in organic solvents like ethanol and acetone. The compound is reactive towards bases and can undergo esterification and substitution reactions. It is often used in various chemical syntheses and pharmaceutical applications.

About

CAS No 16642-79-8
English Name 3-(4-Nitrophenyl)propanoic acid
Molecular Formula C9H9NO4
Molecular Weight 195.17 g/mol
SMILES C1=CC(=CC=C1CCC(=O)O)[N+](=O)[O-]
InChIKey VZOPVJNBOQOLPN-UHFFFAOYSA-N
Last Updated: 2025-09-22 19:21

Related Q&A

Compound Q&A

How is 3-(4-Nitrophenyl)propanoic acid (CAS: 16642-79-8) typically synthesized?

3-(4-Nitrophenyl)propanoic acid (CAS: 16642-79-8) is typically synthesized by reacting 4-nitrophenyl...

Compound Q&A

What industries use 3-(4-Nitrophenyl)propanoic acid (CAS: 16642-79-8)?

3-(4-Nitrophenyl)propanoic acid (CAS: 16642-79-8) is primarily used in the pharmaceutical industry f...

Compound Q&A

What precautions should be taken when handling 3-(4-Nitrophenyl)propanoic acid (CAS: 16642-79-8)?

When handling 3-(4-Nitrophenyl)propanoic acid (CAS: 16642-79-8), it is important to wear appropriate...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...