Compound Q&A

What industries use [(dimethylamino)methyl]ferrocene (CAS: 1271-86-9)?

Answer

Ferrocene, [(dimethylamino)methyl]-
[(Dimethylamino)methyl]ferrocene is used in the pharmaceutical industry for the synthesis of certain drugs, in polymer chemistry for the development of advanced materials, and in catalysis as a ligand in homogeneous catalytic processes. It also has applications in sensors and semiconductor technology.

About

CAS No 1271-86-9
English Name Ferrocene, [(dimethylamino)methyl]-
Molecular Formula C13H17FeN
Molecular Weight 243.13 g/mol
EINECS 215-044-8
SMILES [CH-]1C=CC=C1.CN(C[C-]1C=CC=C1)C.[Fe+2]
InChIKey JJJSTEANRWLZBH-UHFFFAOYSA-N
Last Updated: 2025-09-22 19:21

Related Q&A

Compound Q&A

What are the physical and chemical properties of [(dimethylamino)methyl]ferrocene (CAS: 1271-86-9)?

[(Dimethylamino)methyl]ferrocene is a yellow crystalline solid with a molecular weight of approximat...

Compound Q&A

How is [(dimethylamino)methyl]ferrocene (CAS: 1271-86-9) typically synthesized?

[(Dimethylamino)methyl]ferrocene is usually synthesized through the reaction of ferrocene with dimet...

Compound Q&A

What precautions should be taken when handling [(dimethylamino)methyl]ferrocene (CAS: 1271-86-9)?

When handling [(dimethylamino)methyl]ferrocene, it is crucial to wear appropriate personal protectiv...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...