Compound Q&A

What are the physical and chemical properties of [(dimethylamino)methyl]ferrocene (CAS: 1271-86-9)?

Answer

Ferrocene, [(dimethylamino)methyl]-
[(Dimethylamino)methyl]ferrocene is a yellow crystalline solid with a molecular weight of approximately 216.29 g/mol. It has low solubility in water but is more soluble in organic solvents like ethanol and acetone. Chemically, it is relatively stable but can react with strong oxidizing agents. It is used in organic synthesis and as a ligand in catalysis.

About

CAS No 1271-86-9
English Name Ferrocene, [(dimethylamino)methyl]-
Molecular Formula C13H17FeN
Molecular Weight 243.13 g/mol
EINECS 215-044-8
SMILES [CH-]1C=CC=C1.CN(C[C-]1C=CC=C1)C.[Fe+2]
InChIKey JJJSTEANRWLZBH-UHFFFAOYSA-N
Last Updated: 2025-09-22 19:21

Related Q&A

Compound Q&A

How is [(dimethylamino)methyl]ferrocene (CAS: 1271-86-9) typically synthesized?

[(Dimethylamino)methyl]ferrocene is usually synthesized through the reaction of ferrocene with dimet...

Compound Q&A

What industries use [(dimethylamino)methyl]ferrocene (CAS: 1271-86-9)?

[(Dimethylamino)methyl]ferrocene is used in the pharmaceutical industry for the synthesis of certain...

Compound Q&A

What precautions should be taken when handling [(dimethylamino)methyl]ferrocene (CAS: 1271-86-9)?

When handling [(dimethylamino)methyl]ferrocene, it is crucial to wear appropriate personal protectiv...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...