Compound Q&A

How is [(dimethylamino)methyl]ferrocene (CAS: 1271-86-9) typically synthesized?

Answer

Ferrocene, [(dimethylamino)methyl]-
[(Dimethylamino)methyl]ferrocene is usually synthesized through the reaction of ferrocene with dimethylaminomethyl chloride in the presence of a base like triethylamine. The reaction is typically carried out in an inert solvent such as dichloromethane at room temperature, yielding the compound with good selectivity and high yield.

About

CAS No 1271-86-9
English Name Ferrocene, [(dimethylamino)methyl]-
Molecular Formula C13H17FeN
Molecular Weight 243.13 g/mol
EINECS 215-044-8
SMILES [CH-]1C=CC=C1.CN(C[C-]1C=CC=C1)C.[Fe+2]
InChIKey JJJSTEANRWLZBH-UHFFFAOYSA-N
Last Updated: 2025-09-22 19:21

Related Q&A

Compound Q&A

What are the physical and chemical properties of [(dimethylamino)methyl]ferrocene (CAS: 1271-86-9)?

[(Dimethylamino)methyl]ferrocene is a yellow crystalline solid with a molecular weight of approximat...

Compound Q&A

What industries use [(dimethylamino)methyl]ferrocene (CAS: 1271-86-9)?

[(Dimethylamino)methyl]ferrocene is used in the pharmaceutical industry for the synthesis of certain...

Compound Q&A

What precautions should be taken when handling [(dimethylamino)methyl]ferrocene (CAS: 1271-86-9)?

When handling [(dimethylamino)methyl]ferrocene, it is crucial to wear appropriate personal protectiv...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...