Compound Q&A

What industries use Iron(2+) 2,4-cyclopentadienide 1-ethyl-2,4-cyclopentadienide (1:1:1) (CAS: 1273-89-8)?

Answer

Iron(2+) 2,4-cyclopentadienide 1-ethyl-2,4-cyclopentadienide (1:1:1)
Iron(2+) 2,4-cyclopentadienide 1-ethyl-2,4-cyclopentadienide (1:1:1) finds applications in the pharmaceutical industry for the synthesis of organometallic compounds, in polymer chemistry for the preparation of functionalized polymers, and in the production of sensors and semiconductors due to its unique electronic and structural properties.

About

CAS No 1273-89-8
English Name Iron(2+) 2,4-cyclopentadienide 1-ethyl-2,4-cyclopentadienide (1:1:1)
Molecular Formula C12H14Fe
Molecular Weight 214.08 g/mol
EINECS 215-056-3
SMILES CC[c-]1cccc1.[cH-]1cccc1.[Fe+2]
InChIKey FCNXGBYXGSKCDG-UHFFFAOYSA-N
Last Updated: 2025-09-22 19:21

Related Q&A

Compound Q&A

What are the physical and chemical properties of Iron(2+) 2,4-cyclopentadienide 1-ethyl-2,4-cyclopentadienide (1:1:1) (CAS: 1273-89-8)?

Iron(2+) 2,4-cyclopentadienide 1-ethyl-2,4-cyclopentadienide (1:1:1) is a crystalline compound with ...

Compound Q&A

How is Iron(2+) 2,4-cyclopentadienide 1-ethyl-2,4-cyclopentadienide (1:1:1) (CAS: 1273-89-8) typically synthesized?

Iron(2+) 2,4-cyclopentadienide 1-ethyl-2,4-cyclopentadienide (1:1:1) is typically synthesized throug...

Compound Q&A

What precautions should be taken when handling Iron(2+) 2,4-cyclopentadienide 1-ethyl-2,4-cyclopentadienide (1:1:1) (CAS: 1273-89-8)?

When handling Iron(2+) 2,4-cyclopentadienide 1-ethyl-2,4-cyclopentadienide (1:1:1), it is crucial to...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...