Compound Q&A

How is Iron(2+) 2,4-cyclopentadienide 1-ethyl-2,4-cyclopentadienide (1:1:1) (CAS: 1273-89-8) typically synthesized?

Answer

Iron(2+) 2,4-cyclopentadienide 1-ethyl-2,4-cyclopentadienide (1:1:1)
Iron(2+) 2,4-cyclopentadienide 1-ethyl-2,4-cyclopentadienide (1:1:1) is typically synthesized through the reaction of iron(II) chloride with 2,4-cyclopentadienyl ligands and 1-ethyl-2,4-cyclopentadienyl ligands under controlled conditions. This process involves the use of catalytic amounts of suitable ligands and requires precise stoichiometry and reaction conditions to achieve the desired yield and selectivity.

About

CAS No 1273-89-8
English Name Iron(2+) 2,4-cyclopentadienide 1-ethyl-2,4-cyclopentadienide (1:1:1)
Molecular Formula C12H14Fe
Molecular Weight 214.08 g/mol
EINECS 215-056-3
SMILES CC[c-]1cccc1.[cH-]1cccc1.[Fe+2]
InChIKey FCNXGBYXGSKCDG-UHFFFAOYSA-N
Last Updated: 2025-09-22 19:21

Related Q&A

Compound Q&A

What are the physical and chemical properties of Iron(2+) 2,4-cyclopentadienide 1-ethyl-2,4-cyclopentadienide (1:1:1) (CAS: 1273-89-8)?

Iron(2+) 2,4-cyclopentadienide 1-ethyl-2,4-cyclopentadienide (1:1:1) is a crystalline compound with ...

Compound Q&A

What industries use Iron(2+) 2,4-cyclopentadienide 1-ethyl-2,4-cyclopentadienide (1:1:1) (CAS: 1273-89-8)?

Iron(2+) 2,4-cyclopentadienide 1-ethyl-2,4-cyclopentadienide (1:1:1) finds applications in the pharm...

Compound Q&A

What precautions should be taken when handling Iron(2+) 2,4-cyclopentadienide 1-ethyl-2,4-cyclopentadienide (1:1:1) (CAS: 1273-89-8)?

When handling Iron(2+) 2,4-cyclopentadienide 1-ethyl-2,4-cyclopentadienide (1:1:1), it is crucial to...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...