Compound Q&A

What are the physical and chemical properties of Iron(2+) 2,4-cyclopentadienide 1-ethyl-2,4-cyclopentadienide (1:1:1) (CAS: 1273-89-8)?

Answer

Iron(2+) 2,4-cyclopentadienide 1-ethyl-2,4-cyclopentadienide (1:1:1)
Iron(2+) 2,4-cyclopentadienide 1-ethyl-2,4-cyclopentadienide (1:1:1) is a crystalline compound with a molecular weight of approximately 306.25 g/mol. It has a low solubility in water but is soluble in organic solvents. It is an unstable compound with tendencies for ligand exchange reactions and other coordination chemistry phenomena.

About

CAS No 1273-89-8
English Name Iron(2+) 2,4-cyclopentadienide 1-ethyl-2,4-cyclopentadienide (1:1:1)
Molecular Formula C12H14Fe
Molecular Weight 214.08 g/mol
EINECS 215-056-3
SMILES CC[c-]1cccc1.[cH-]1cccc1.[Fe+2]
InChIKey FCNXGBYXGSKCDG-UHFFFAOYSA-N
Last Updated: 2025-09-22 19:21

Related Q&A

Compound Q&A

How is Iron(2+) 2,4-cyclopentadienide 1-ethyl-2,4-cyclopentadienide (1:1:1) (CAS: 1273-89-8) typically synthesized?

Iron(2+) 2,4-cyclopentadienide 1-ethyl-2,4-cyclopentadienide (1:1:1) is typically synthesized throug...

Compound Q&A

What industries use Iron(2+) 2,4-cyclopentadienide 1-ethyl-2,4-cyclopentadienide (1:1:1) (CAS: 1273-89-8)?

Iron(2+) 2,4-cyclopentadienide 1-ethyl-2,4-cyclopentadienide (1:1:1) finds applications in the pharm...

Compound Q&A

What precautions should be taken when handling Iron(2+) 2,4-cyclopentadienide 1-ethyl-2,4-cyclopentadienide (1:1:1) (CAS: 1273-89-8)?

When handling Iron(2+) 2,4-cyclopentadienide 1-ethyl-2,4-cyclopentadienide (1:1:1), it is crucial to...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...