Compound Q&A

What industries use 1H-Indol-3-yl N-[(4-methylphenyl)sulfonyl]-L-alaninate (CAS: 75062-54-3)?

Answer

1H-Indol-3-yl N-[(4-methylphenyl)sulfonyl]-L-alaninate
1H-Indol-3-yl N-[(4-methylphenyl)sulfonyl]-L-alaninate finds applications in the pharmaceutical industry for its potential as a bioactive compound. It also has relevance in the polymer industry for its use as a monomer in the synthesis of novel materials with specific electronic properties. Additionally, it can be used in the development of sensors and semiconductors.

About

CAS No 75062-54-3
English Name 1H-Indol-3-yl N-[(4-methylphenyl)sulfonyl]-L-alaninate
Molecular Formula C18H18N2O4S
Molecular Weight 358.42 g/mol
SMILES CC1=CC=C(C=C1)S(=O)(=O)NC(C)C(=O)OC2=CNC3=CC=CC=C32
InChIKey CBIVSVOVPJAVRE-ZDUSSCGKSA-N
Last Updated: 2025-09-22 19:21

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1H-Indol-3-yl N-[(4-methylphenyl)sulfonyl]-L-alaninate (CAS: 75062-54-3)?

1H-Indol-3-yl N-[(4-methylphenyl)sulfonyl]-L-alaninate is a white crystalline solid with a molecular...

Compound Q&A

How is 1H-Indol-3-yl N-[(4-methylphenyl)sulfonyl]-L-alaninate (CAS: 75062-54-3) typically synthesized?

1H-Indol-3-yl N-[(4-methylphenyl)sulfonyl]-L-alaninate is synthesized through a multistep process in...

Compound Q&A

What precautions should be taken when handling 1H-Indol-3-yl N-[(4-methylphenyl)sulfonyl]-L-alaninate (CAS: 75062-54-3)?

When handling 1H-Indol-3-yl N-[(4-methylphenyl)sulfonyl]-L-alaninate, it is crucial to wear appropri...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...