Compound Q&A

What are the physical and chemical properties of 1H-Indol-3-yl N-[(4-methylphenyl)sulfonyl]-L-alaninate (CAS: 75062-54-3)?

Answer

1H-Indol-3-yl N-[(4-methylphenyl)sulfonyl]-L-alaninate
1H-Indol-3-yl N-[(4-methylphenyl)sulfonyl]-L-alaninate is a white crystalline solid with a molecular weight of approximately 394.46 g/mol. It has a low solubility in water but is more soluble in organic solvents like methanol and ethanol. This compound is reactive towards nucleophiles and is susceptible to hydrolysis under basic conditions.

About

CAS No 75062-54-3
English Name 1H-Indol-3-yl N-[(4-methylphenyl)sulfonyl]-L-alaninate
Molecular Formula C18H18N2O4S
Molecular Weight 358.42 g/mol
SMILES CC1=CC=C(C=C1)S(=O)(=O)NC(C)C(=O)OC2=CNC3=CC=CC=C32
InChIKey CBIVSVOVPJAVRE-ZDUSSCGKSA-N
Last Updated: 2025-09-22 19:21

Related Q&A

Compound Q&A

How is 1H-Indol-3-yl N-[(4-methylphenyl)sulfonyl]-L-alaninate (CAS: 75062-54-3) typically synthesized?

1H-Indol-3-yl N-[(4-methylphenyl)sulfonyl]-L-alaninate is synthesized through a multistep process in...

Compound Q&A

What industries use 1H-Indol-3-yl N-[(4-methylphenyl)sulfonyl]-L-alaninate (CAS: 75062-54-3)?

1H-Indol-3-yl N-[(4-methylphenyl)sulfonyl]-L-alaninate finds applications in the pharmaceutical indu...

Compound Q&A

What precautions should be taken when handling 1H-Indol-3-yl N-[(4-methylphenyl)sulfonyl]-L-alaninate (CAS: 75062-54-3)?

When handling 1H-Indol-3-yl N-[(4-methylphenyl)sulfonyl]-L-alaninate, it is crucial to wear appropri...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...