Compound Q&A

What industries use Methyl 2-amino-4,5-dimethoxybenzoate (CAS: 26759-46-6)?

Answer

Methyl 2-amino-4,5-dimethoxybenzoate
Methyl 2-amino-4,5-dimethoxybenzoate (CAS: 26759-46-6) is used in the pharmaceutical industry as a precursor for the synthesis of various drugs. It is also used in the polymer industry as a monomer for the production of functional polymers. Additionally, it can be used in the sensor industry due to its chemical reactivity and in the semiconductor industry for specific applications requiring organo-metallic compounds.

About

CAS No 26759-46-6
English Name Methyl 2-amino-4,5-dimethoxybenzoate
Molecular Formula C10H13NO4
Molecular Weight 211.22 g/mol
SMILES COC1=C(C=C(C(=C1)C(=O)OC)N)OC
InChIKey QQFHCCQSCQBKBG-UHFFFAOYSA-N
Last Updated: 2025-09-22 19:21

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 2-amino-4,5-dimethoxybenzoate (CAS: 26759-46-6)?

Methyl 2-amino-4,5-dimethoxybenzoate (CAS: 26759-46-6) is a white crystalline solid with a molecular...

Compound Q&A

How is Methyl 2-amino-4,5-dimethoxybenzoate (CAS: 26759-46-6) typically synthesized?

Methyl 2-amino-4,5-dimethoxybenzoate (CAS: 26759-46-6) is typically synthesized by the reaction of 4...

Compound Q&A

What precautions should be taken when handling Methyl 2-amino-4,5-dimethoxybenzoate (CAS: 26759-46-6)?

When handling Methyl 2-amino-4,5-dimethoxybenzoate (CAS: 26759-46-6), it is important to wear approp...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...