Compound Q&A

What are the physical and chemical properties of Methyl 2-amino-4,5-dimethoxybenzoate (CAS: 26759-46-6)?

Answer

Methyl 2-amino-4,5-dimethoxybenzoate
Methyl 2-amino-4,5-dimethoxybenzoate (CAS: 26759-46-6) is a white crystalline solid with a molecular weight of approximately 260.31 g/mol. It is slightly soluble in water but more soluble in organic solvents such as ethanol and acetone. The compound has low reactivity under normal conditions but can undergo substitution reactions under certain conditions. It has a strong amine group and methoxy groups, which can participate in various chemical reactions.

About

CAS No 26759-46-6
English Name Methyl 2-amino-4,5-dimethoxybenzoate
Molecular Formula C10H13NO4
Molecular Weight 211.22 g/mol
SMILES COC1=C(C=C(C(=C1)C(=O)OC)N)OC
InChIKey QQFHCCQSCQBKBG-UHFFFAOYSA-N
Last Updated: 2025-09-22 19:21

Related Q&A

Compound Q&A

How is Methyl 2-amino-4,5-dimethoxybenzoate (CAS: 26759-46-6) typically synthesized?

Methyl 2-amino-4,5-dimethoxybenzoate (CAS: 26759-46-6) is typically synthesized by the reaction of 4...

Compound Q&A

What industries use Methyl 2-amino-4,5-dimethoxybenzoate (CAS: 26759-46-6)?

Methyl 2-amino-4,5-dimethoxybenzoate (CAS: 26759-46-6) is used in the pharmaceutical industry as a p...

Compound Q&A

What precautions should be taken when handling Methyl 2-amino-4,5-dimethoxybenzoate (CAS: 26759-46-6)?

When handling Methyl 2-amino-4,5-dimethoxybenzoate (CAS: 26759-46-6), it is important to wear approp...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...