Compound Q&A

What industries use Diphenyl isophthalate (CAS: 744-45-6)?

Answer

Diphenyl isophthalate
Diphenyl isophthalate (CAS: 744-45-6) is primarily used in the polymer industry as a component in the production of polyesters and as an intermediate in the synthesis of other chemical compounds. It also finds applications in the pharmaceutical industry, where it is used as a precursor in the synthesis of certain drugs. Additionally, it is used in the manufacturing of sensors and semiconductors due to its specific chemical and physical properties.

About

CAS No 744-45-6
English Name Diphenyl isophthalate
Molecular Formula C20H14O4
Molecular Weight 318.33 g/mol
SMILES C1=CC=C(C=C1)OC(=O)C2=CC(=CC=C2)C(=O)OC3=CC=CC=C3
InChIKey FHESUNXRPBHDQM-UHFFFAOYSA-N
Last Updated: 2025-09-19 21:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of Diphenyl isophthalate (CAS: 744-45-6)?

Diphenyl isophthalate (CAS: 744-45-6) is a crystalline solid with a molecular weight of approximatel...

Compound Q&A

How is Diphenyl isophthalate (CAS: 744-45-6) typically synthesized?

Diphenyl isophthalate is typically synthesized by the esterification of isophthalic acid with diphen...

Compound Q&A

What precautions should be taken when handling Diphenyl isophthalate (CAS: 744-45-6)?

When handling Diphenyl isophthalate (CAS: 744-45-6), it is essential to wear appropriate personal pr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...