Compound Q&A

What are the physical and chemical properties of Diphenyl isophthalate (CAS: 744-45-6)?

Answer

Diphenyl isophthalate
Diphenyl isophthalate (CAS: 744-45-6) is a crystalline solid with a molecular weight of approximately 286.17 g/mol. It has a melting point of around 140°C and is slightly soluble in water but soluble in organic solvents like acetone and acetonitrile. The compound is relatively stable but can undergo hydrolysis in the presence of water and heat. It is not readily reactive under normal conditions but can react with strong bases to form phenylphenyl isophthalate salts.

About

CAS No 744-45-6
English Name Diphenyl isophthalate
Molecular Formula C20H14O4
Molecular Weight 318.33 g/mol
SMILES C1=CC=C(C=C1)OC(=O)C2=CC(=CC=C2)C(=O)OC3=CC=CC=C3
InChIKey FHESUNXRPBHDQM-UHFFFAOYSA-N
Last Updated: 2025-09-19 21:14

Related Q&A

Compound Q&A

How is Diphenyl isophthalate (CAS: 744-45-6) typically synthesized?

Diphenyl isophthalate is typically synthesized by the esterification of isophthalic acid with diphen...

Compound Q&A

What industries use Diphenyl isophthalate (CAS: 744-45-6)?

Diphenyl isophthalate (CAS: 744-45-6) is primarily used in the polymer industry as a component in th...

Compound Q&A

What precautions should be taken when handling Diphenyl isophthalate (CAS: 744-45-6)?

When handling Diphenyl isophthalate (CAS: 744-45-6), it is essential to wear appropriate personal pr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...