Compound Q&A

What are the physical and chemical properties of 5-Fluoro-2-benzofuran-1,3-dione (CAS: 319-03-9)?

Answer

5-Fluoro-2-benzofuran-1,3-dione
5-Fluoro-2-benzofuran-1,3-dione is a crystalline solid with a molecular weight of approximately 219.07 g/mol. It has a low solubility in water but is more soluble in organic solvents like ethanol and acetone. Chemically, it is known for its stability but can react with bases and certain organic reagents. It is used in various chemical transformations due to its reactivity with nucleophiles.

About

CAS No 319-03-9
English Name 5-Fluoro-2-benzofuran-1,3-dione
Molecular Formula C8H3FO3
Molecular Weight 166.11 g/mol
SMILES C1=CC2=C(C=C1F)C(=O)OC2=O
InChIKey XVMKZAAFVWXIII-UHFFFAOYSA-N
Last Updated: 2025-09-19 21:14

Related Q&A

Compound Q&A

How is 5-Fluoro-2-benzofuran-1,3-dione (CAS: 319-03-9) typically synthesized?

5-Fluoro-2-benzofuran-1,3-dione is typically synthesized via the oxidation of 5-fluoro-2-benzofuran ...

Compound Q&A

What industries use 5-Fluoro-2-benzofuran-1,3-dione (CAS: 319-03-9)?

5-Fluoro-2-benzofuran-1,3-dione is used in the pharmaceutical industry for the synthesis of certain ...

Compound Q&A

What precautions should be taken when handling 5-Fluoro-2-benzofuran-1,3-dione (CAS: 319-03-9)?

When handling 5-Fluoro-2-benzofuran-1,3-dione, it is crucial to wear appropriate personal protective...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...