Compound Q&A

What industries use 2,2',5,5'-Tetrachloro-4,4'-biphenyldiamine (CAS: 15721-02-5)?

Answer

2,2',5,5'-Tetrachloro-4,4'-biphenyldiamine
2,2',5,5'-Tetrachloro-4,4'-biphenyldiamine is used in the pharmaceutical industry for the synthesis of certain intermediates. It is also utilized in the polymer industry for the production of certain types of plastics and resins. Additionally, it has applications in the semiconductor industry for etching agents and in the field of sensors for its specific reactivity with certain chemical species.

About

CAS No 15721-02-5
English Name 2,2',5,5'-Tetrachloro-4,4'-biphenyldiamine
Molecular Formula C12H8Cl4N2
Molecular Weight 322.02 g/mol
SMILES C1=C(C(=CC(=C1Cl)N)Cl)C2=CC(=C(C=C2Cl)N)Cl
InChIKey UXOXUHMFQZEAFR-UHFFFAOYSA-N
Last Updated: 2025-09-19 21:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,2',5,5'-Tetrachloro-4,4'-biphenyldiamine (CAS: 15721-02-5)?

2,2',5,5'-Tetrachloro-4,4'-biphenyldiamine is a white crystalline solid with a molecular weight of 4...

Compound Q&A

How is 2,2',5,5'-Tetrachloro-4,4'-biphenyldiamine (CAS: 15721-02-5) typically synthesized?

2,2',5,5'-Tetrachloro-4,4'-biphenyldiamine is usually synthesized via the condensation of 2,5-dichlo...

Compound Q&A

What precautions should be taken when handling 2,2',5,5'-Tetrachloro-4,4'-biphenyldiamine (CAS: 15721-02-5)?

When handling 2,2',5,5'-Tetrachloro-4,4'-biphenyldiamine, it is crucial to wear appropriate personal...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...