Compound Q&A

How is 2,2',5,5'-Tetrachloro-4,4'-biphenyldiamine (CAS: 15721-02-5) typically synthesized?

Answer

2,2',5,5'-Tetrachloro-4,4'-biphenyldiamine
2,2',5,5'-Tetrachloro-4,4'-biphenyldiamine is usually synthesized via the condensation of 2,5-dichlorobiphenyl with hydrazine hydrate. This process generally involves the use of anhydrous conditions and a suitable catalyst such as p-toluenesulfonic acid (PTSA) to improve yield and selectivity. The product is then purified by recrystallization.

About

CAS No 15721-02-5
English Name 2,2',5,5'-Tetrachloro-4,4'-biphenyldiamine
Molecular Formula C12H8Cl4N2
Molecular Weight 322.02 g/mol
SMILES C1=C(C(=CC(=C1Cl)N)Cl)C2=CC(=C(C=C2Cl)N)Cl
InChIKey UXOXUHMFQZEAFR-UHFFFAOYSA-N
Last Updated: 2025-09-19 21:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,2',5,5'-Tetrachloro-4,4'-biphenyldiamine (CAS: 15721-02-5)?

2,2',5,5'-Tetrachloro-4,4'-biphenyldiamine is a white crystalline solid with a molecular weight of 4...

Compound Q&A

What industries use 2,2',5,5'-Tetrachloro-4,4'-biphenyldiamine (CAS: 15721-02-5)?

2,2',5,5'-Tetrachloro-4,4'-biphenyldiamine is used in the pharmaceutical industry for the synthesis ...

Compound Q&A

What precautions should be taken when handling 2,2',5,5'-Tetrachloro-4,4'-biphenyldiamine (CAS: 15721-02-5)?

When handling 2,2',5,5'-Tetrachloro-4,4'-biphenyldiamine, it is crucial to wear appropriate personal...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...