Compound Q&A

What are the physical and chemical properties of 2,2',5,5'-Tetrachloro-4,4'-biphenyldiamine (CAS: 15721-02-5)?

Answer

2,2',5,5'-Tetrachloro-4,4'-biphenyldiamine
2,2',5,5'-Tetrachloro-4,4'-biphenyldiamine is a white crystalline solid with a molecular weight of 409.04 g/mol. It has a low solubility in water but is more soluble in organic solvents such as ethanol and acetone. The compound is relatively stable under normal conditions but can react with reducing agents. It is not flammable and has a melting point of 208-209°C.

About

CAS No 15721-02-5
English Name 2,2',5,5'-Tetrachloro-4,4'-biphenyldiamine
Molecular Formula C12H8Cl4N2
Molecular Weight 322.02 g/mol
SMILES C1=C(C(=CC(=C1Cl)N)Cl)C2=CC(=C(C=C2Cl)N)Cl
InChIKey UXOXUHMFQZEAFR-UHFFFAOYSA-N
Last Updated: 2025-09-19 21:14

Related Q&A

Compound Q&A

How is 2,2',5,5'-Tetrachloro-4,4'-biphenyldiamine (CAS: 15721-02-5) typically synthesized?

2,2',5,5'-Tetrachloro-4,4'-biphenyldiamine is usually synthesized via the condensation of 2,5-dichlo...

Compound Q&A

What industries use 2,2',5,5'-Tetrachloro-4,4'-biphenyldiamine (CAS: 15721-02-5)?

2,2',5,5'-Tetrachloro-4,4'-biphenyldiamine is used in the pharmaceutical industry for the synthesis ...

Compound Q&A

What precautions should be taken when handling 2,2',5,5'-Tetrachloro-4,4'-biphenyldiamine (CAS: 15721-02-5)?

When handling 2,2',5,5'-Tetrachloro-4,4'-biphenyldiamine, it is crucial to wear appropriate personal...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...