Compound Q&A

What precautions should be taken when handling (2S)-(2-Chlorophenyl)(hydroxy)acetic acid (CAS: 52950-19-3)?

Answer

(2S)-(2-Chlorophenyl)(hydroxy)acetic acid
When handling (2S)-(2-Chlorophenyl)(hydroxy)acetic acid, it is crucial to wear appropriate personal protective equipment (PPE), including gloves, safety goggles, and a lab coat. Work in a well-ventilated area or fume hood to avoid inhaling vapors. Spills should be cleaned up using protective gear and proper spill kits. Always refer to the Safety Data Sheet (SDS) for detailed handling and disposal information.

About

CAS No 52950-19-3
English Name (2S)-(2-Chlorophenyl)(hydroxy)acetic acid
Molecular Formula C8H7ClO3
Molecular Weight 186.59 g/mol
SMILES C1=CC=C(C(=C1)C(C(=O)O)O)Cl
InChIKey RWOLDZZTBNYTMS-ZETCQYMHSA-N
Last Updated: 2025-09-19 21:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2S)-(2-Chlorophenyl)(hydroxy)acetic acid (CAS: 52950-19-3)?

The physical and chemical properties of (2S)-(2-Chlorophenyl)(hydroxy)acetic acid include a white or...

Compound Q&A

How is (2S)-(2-Chlorophenyl)(hydroxy)acetic acid (CAS: 52950-19-3) typically synthesized?

The synthesis of (2S)-(2-Chlorophenyl)(hydroxy)acetic acid typically involves the condensation of 2-...

Compound Q&A

What industries use (2S)-(2-Chlorophenyl)(hydroxy)acetic acid (CAS: 52950-19-3)?

The (2S)-(2-Chlorophenyl)(hydroxy)acetic acid (CAS: 52950-19-3) is utilized in the pharmaceutical in...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...