Compound Q&A

What are the physical and chemical properties of (2S)-(2-Chlorophenyl)(hydroxy)acetic acid (CAS: 52950-19-3)?

Answer

(2S)-(2-Chlorophenyl)(hydroxy)acetic acid
The physical and chemical properties of (2S)-(2-Chlorophenyl)(hydroxy)acetic acid include a white or off-white crystalline solid with a molecular weight of approximately 224.63 g/mol. It has a low solubility in water (0.4 g/100 mL at 25°C) and exhibits acidity due to the carboxylic acid group. The compound is reactive towards bases and can form salts. It is also susceptible to hydrolysis under basic conditions.

About

CAS No 52950-19-3
English Name (2S)-(2-Chlorophenyl)(hydroxy)acetic acid
Molecular Formula C8H7ClO3
Molecular Weight 186.59 g/mol
SMILES C1=CC=C(C(=C1)C(C(=O)O)O)Cl
InChIKey RWOLDZZTBNYTMS-ZETCQYMHSA-N
Last Updated: 2025-09-19 21:14

Related Q&A

Compound Q&A

How is (2S)-(2-Chlorophenyl)(hydroxy)acetic acid (CAS: 52950-19-3) typically synthesized?

The synthesis of (2S)-(2-Chlorophenyl)(hydroxy)acetic acid typically involves the condensation of 2-...

Compound Q&A

What industries use (2S)-(2-Chlorophenyl)(hydroxy)acetic acid (CAS: 52950-19-3)?

The (2S)-(2-Chlorophenyl)(hydroxy)acetic acid (CAS: 52950-19-3) is utilized in the pharmaceutical in...

Compound Q&A

What precautions should be taken when handling (2S)-(2-Chlorophenyl)(hydroxy)acetic acid (CAS: 52950-19-3)?

When handling (2S)-(2-Chlorophenyl)(hydroxy)acetic acid, it is crucial to wear appropriate personal ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...