Compound Q&A

How is (2S)-(2-Chlorophenyl)(hydroxy)acetic acid (CAS: 52950-19-3) typically synthesized?

Answer

(2S)-(2-Chlorophenyl)(hydroxy)acetic acid
The synthesis of (2S)-(2-Chlorophenyl)(hydroxy)acetic acid typically involves the condensation of 2-chlorophenol with acetic anhydride, followed by hydrolysis to form the acetic acid derivative. Commonly, a strong base like sodium hydroxide is used in the hydrolysis step. The process requires careful control of pH and temperature to achieve high yields and selectivity.

About

CAS No 52950-19-3
English Name (2S)-(2-Chlorophenyl)(hydroxy)acetic acid
Molecular Formula C8H7ClO3
Molecular Weight 186.59 g/mol
SMILES C1=CC=C(C(=C1)C(C(=O)O)O)Cl
InChIKey RWOLDZZTBNYTMS-ZETCQYMHSA-N
Last Updated: 2025-09-19 21:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2S)-(2-Chlorophenyl)(hydroxy)acetic acid (CAS: 52950-19-3)?

The physical and chemical properties of (2S)-(2-Chlorophenyl)(hydroxy)acetic acid include a white or...

Compound Q&A

What industries use (2S)-(2-Chlorophenyl)(hydroxy)acetic acid (CAS: 52950-19-3)?

The (2S)-(2-Chlorophenyl)(hydroxy)acetic acid (CAS: 52950-19-3) is utilized in the pharmaceutical in...

Compound Q&A

What precautions should be taken when handling (2S)-(2-Chlorophenyl)(hydroxy)acetic acid (CAS: 52950-19-3)?

When handling (2S)-(2-Chlorophenyl)(hydroxy)acetic acid, it is crucial to wear appropriate personal ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...