Compound Q&A

What precautions should be taken when handling 4-Nitro-N,N-bis(4-nitrophenyl)aniline (CAS: 20440-93-1)?

Answer

4-Nitro-N,N-bis(4-nitrophenyl)aniline
Proper handling of 4-Nitro-N,N-bis(4-nitrophenyl)aniline requires the use of personal protective equipment (PPE) including gloves, safety goggles, and a lab coat to protect against skin and eye exposure. This compound should be handled in a well-ventilated area or fume hood to minimize inhalation risk. In case of a spill, it is recommended to use appropriate spill cleanup materials and follow the manufacturer's safety data sheet (SDS) for disposal and cleanup procedures.

About

CAS No 20440-93-1
English Name 4-Nitro-N,N-bis(4-nitrophenyl)aniline
Molecular Formula C18H12N4O6
Molecular Weight 380.32 g/mol
SMILES C1=CC(=CC=C1N(C2=CC=C(C=C2)[N+](=O)[O-])C3=CC=C(C=C3)[N+](=O)[O-])[N+](=O)[O-]
InChIKey LSNJBIDKQIRWRQ-UHFFFAOYSA-N
Last Updated: 2025-09-19 21:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Nitro-N,N-bis(4-nitrophenyl)aniline (CAS: 20440-93-1)?

4-Nitro-N,N-bis(4-nitrophenyl)aniline is a crystalline compound with a molecular weight of approxima...

Compound Q&A

How is 4-Nitro-N,N-bis(4-nitrophenyl)aniline (CAS: 20440-93-1) typically synthesized?

4-Nitro-N,N-bis(4-nitrophenyl)aniline is typically synthesized through a multi-step process involvin...

Compound Q&A

What industries use 4-Nitro-N,N-bis(4-nitrophenyl)aniline (CAS: 20440-93-1)?

4-Nitro-N,N-bis(4-nitrophenyl)aniline is primarily used in the pharmaceutical industry as a precurso...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...