Compound Q&A

What are the physical and chemical properties of 4-Nitro-N,N-bis(4-nitrophenyl)aniline (CAS: 20440-93-1)?

Answer

4-Nitro-N,N-bis(4-nitrophenyl)aniline
4-Nitro-N,N-bis(4-nitrophenyl)aniline is a crystalline compound with a molecular weight of approximately 332.07 g/mol. It has a high solubility in organic solvents like ethanol and acetone but is practically insoluble in water. This compound is known for its high reactivity due to the presence of multiple nitro groups, which can participate in various chemical reactions such as nucleophilic aromatic substitution and electrophilic addition.

About

CAS No 20440-93-1
English Name 4-Nitro-N,N-bis(4-nitrophenyl)aniline
Molecular Formula C18H12N4O6
Molecular Weight 380.32 g/mol
SMILES C1=CC(=CC=C1N(C2=CC=C(C=C2)[N+](=O)[O-])C3=CC=C(C=C3)[N+](=O)[O-])[N+](=O)[O-]
InChIKey LSNJBIDKQIRWRQ-UHFFFAOYSA-N
Last Updated: 2025-09-19 21:14

Related Q&A

Compound Q&A

How is 4-Nitro-N,N-bis(4-nitrophenyl)aniline (CAS: 20440-93-1) typically synthesized?

4-Nitro-N,N-bis(4-nitrophenyl)aniline is typically synthesized through a multi-step process involvin...

Compound Q&A

What industries use 4-Nitro-N,N-bis(4-nitrophenyl)aniline (CAS: 20440-93-1)?

4-Nitro-N,N-bis(4-nitrophenyl)aniline is primarily used in the pharmaceutical industry as a precurso...

Compound Q&A

What precautions should be taken when handling 4-Nitro-N,N-bis(4-nitrophenyl)aniline (CAS: 20440-93-1)?

Proper handling of 4-Nitro-N,N-bis(4-nitrophenyl)aniline requires the use of personal protective equ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...