Compound Q&A

What industries use 4-Nitro-N,N-bis(4-nitrophenyl)aniline (CAS: 20440-93-1)?

Answer

4-Nitro-N,N-bis(4-nitrophenyl)aniline
4-Nitro-N,N-bis(4-nitrophenyl)aniline is primarily used in the pharmaceutical industry as a precursor for the synthesis of various drug molecules. It also finds applications in the production of dyes and pigments due to its inherent coloring properties. Additionally, this compound is utilized in the development of sensors and semiconductor materials for its electronic and optical properties.

About

CAS No 20440-93-1
English Name 4-Nitro-N,N-bis(4-nitrophenyl)aniline
Molecular Formula C18H12N4O6
Molecular Weight 380.32 g/mol
SMILES C1=CC(=CC=C1N(C2=CC=C(C=C2)[N+](=O)[O-])C3=CC=C(C=C3)[N+](=O)[O-])[N+](=O)[O-]
InChIKey LSNJBIDKQIRWRQ-UHFFFAOYSA-N
Last Updated: 2025-09-19 21:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Nitro-N,N-bis(4-nitrophenyl)aniline (CAS: 20440-93-1)?

4-Nitro-N,N-bis(4-nitrophenyl)aniline is a crystalline compound with a molecular weight of approxima...

Compound Q&A

How is 4-Nitro-N,N-bis(4-nitrophenyl)aniline (CAS: 20440-93-1) typically synthesized?

4-Nitro-N,N-bis(4-nitrophenyl)aniline is typically synthesized through a multi-step process involvin...

Compound Q&A

What precautions should be taken when handling 4-Nitro-N,N-bis(4-nitrophenyl)aniline (CAS: 20440-93-1)?

Proper handling of 4-Nitro-N,N-bis(4-nitrophenyl)aniline requires the use of personal protective equ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...