Compound Q&A

What industries use (4E,6E)-1,7-Diphenyl-4,6-heptadien-3-one (CAS: 33457-62-4)?

Answer

(4E,6E)-1,7-Diphenyl-4,6-heptadien-3-one
(4E,6E)-1,7-Diphenyl-4,6-heptadien-3-one is widely used in the pharmaceutical industry for the synthesis of various medicinal compounds. It is also utilized in the polymer industry to modify polymer properties. Its ability to act as a precursor in semiconductor and sensor technology makes it valuable in these sectors as well.

About

CAS No 33457-62-4
English Name (4E,6E)-1,7-Diphenyl-4,6-heptadien-3-one
Molecular Formula C19H18O
Molecular Weight 262.35 g/mol
SMILES c1ccc(cc1)CCC(=O)/C=C/C=C/c2ccccc2
InChIKey OWMJDOUOHDOUFG-FNCQTZNRSA-N
Last Updated: 2025-09-19 21:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of (4E,6E)-1,7-Diphenyl-4,6-heptadien-3-one (CAS: 33457-62-4)?

(4E,6E)-1,7-Diphenyl-4,6-heptadien-3-one is a colorless solid with a molecular weight of 246.26 g/mo...

Compound Q&A

How is (4E,6E)-1,7-Diphenyl-4,6-heptadien-3-one (CAS: 33457-62-4) typically synthesized?

(4E,6E)-1,7-Diphenyl-4,6-heptadien-3-one can be synthesized via Wittig reaction of a phenylphosphona...

Compound Q&A

What precautions should be taken when handling (4E,6E)-1,7-Diphenyl-4,6-heptadien-3-one (CAS: 33457-62-4)?

When handling (4E,6E)-1,7-Diphenyl-4,6-heptadien-3-one, it is essential to wear appropriate personal...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...