Compound Q&A

How is (4E,6E)-1,7-Diphenyl-4,6-heptadien-3-one (CAS: 33457-62-4) typically synthesized?

Answer

(4E,6E)-1,7-Diphenyl-4,6-heptadien-3-one
(4E,6E)-1,7-Diphenyl-4,6-heptadien-3-one can be synthesized via Wittig reaction of a phenylphosphonate with 1,7-diphenyl-1,3-heptadiene. Alternatively, it can be prepared from a Grignard reagent derived from phenylmagnesium bromide and 1,3-heptadiene. The yield and selectivity are generally good, and appropriate solvents and temperatures are crucial for the reaction to proceed smoothly.

About

CAS No 33457-62-4
English Name (4E,6E)-1,7-Diphenyl-4,6-heptadien-3-one
Molecular Formula C19H18O
Molecular Weight 262.35 g/mol
SMILES c1ccc(cc1)CCC(=O)/C=C/C=C/c2ccccc2
InChIKey OWMJDOUOHDOUFG-FNCQTZNRSA-N
Last Updated: 2025-09-19 21:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of (4E,6E)-1,7-Diphenyl-4,6-heptadien-3-one (CAS: 33457-62-4)?

(4E,6E)-1,7-Diphenyl-4,6-heptadien-3-one is a colorless solid with a molecular weight of 246.26 g/mo...

Compound Q&A

What industries use (4E,6E)-1,7-Diphenyl-4,6-heptadien-3-one (CAS: 33457-62-4)?

(4E,6E)-1,7-Diphenyl-4,6-heptadien-3-one is widely used in the pharmaceutical industry for the synth...

Compound Q&A

What precautions should be taken when handling (4E,6E)-1,7-Diphenyl-4,6-heptadien-3-one (CAS: 33457-62-4)?

When handling (4E,6E)-1,7-Diphenyl-4,6-heptadien-3-one, it is essential to wear appropriate personal...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...