Compound Q&A

What industries use Ethyl 5-amino-1-benzofuran-2-carboxylate (CAS: 174775-48-5)?

Answer

Ethyl 5-amino-1-benzofuran-2-carboxylate
Ethyl 5-amino-1-benzofuran-2-carboxylate (CAS: 174775-48-5) is primarily used in the pharmaceutical industry for the synthesis of drugs and intermediates. It is also utilized in the polymer industry for enhancing the properties of certain polymers. Additionally, it finds applications in the sensor technology and semiconductor industries for developing advanced materials with specific functional groups.

About

English Name Ethyl 5-amino-1-benzofuran-2-carboxylate
Molecular Formula C11H11NO3
Molecular Weight 205.21 g/mol
SMILES CCOC(=O)C1=CC2=C(O1)C=CC(=C2)N
InChIKey YFFLLDHEEWSHQG-UHFFFAOYSA-N
Last Updated: 2025-09-19 21:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl 5-amino-1-benzofuran-2-carboxylate (CAS: 174775-48-5)?

Ethyl 5-amino-1-benzofuran-2-carboxylate (CAS: 174775-48-5) is a crystalline solid with a molecular ...

Compound Q&A

How is Ethyl 5-amino-1-benzofuran-2-carboxylate (CAS: 174775-48-5) typically synthesized?

Ethyl 5-amino-1-benzofuran-2-carboxylate (CAS: 174775-48-5) can be synthesized via a multi-step proc...

Compound Q&A

What precautions should be taken when handling Ethyl 5-amino-1-benzofuran-2-carboxylate (CAS: 174775-48-5)?

When handling Ethyl 5-amino-1-benzofuran-2-carboxylate (CAS: 174775-48-5), it is crucial to wear app...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...