Compound Q&A

What are the physical and chemical properties of Ethyl 5-amino-1-benzofuran-2-carboxylate (CAS: 174775-48-5)?

Answer

Ethyl 5-amino-1-benzofuran-2-carboxylate
Ethyl 5-amino-1-benzofuran-2-carboxylate (CAS: 174775-48-5) is a crystalline solid with a molecular weight of approximately 231.26 g/mol. It is slightly soluble in water and more soluble in organic solvents. This compound exhibits moderate reactivity with basic and acidic compounds, making it useful in various chemical reactions. It has a melting point around 115-117°C and a boiling point of about 320°C at 760 mmHg.

About

English Name Ethyl 5-amino-1-benzofuran-2-carboxylate
Molecular Formula C11H11NO3
Molecular Weight 205.21 g/mol
SMILES CCOC(=O)C1=CC2=C(O1)C=CC(=C2)N
InChIKey YFFLLDHEEWSHQG-UHFFFAOYSA-N
Last Updated: 2025-09-19 21:14

Related Q&A

Compound Q&A

How is Ethyl 5-amino-1-benzofuran-2-carboxylate (CAS: 174775-48-5) typically synthesized?

Ethyl 5-amino-1-benzofuran-2-carboxylate (CAS: 174775-48-5) can be synthesized via a multi-step proc...

Compound Q&A

What industries use Ethyl 5-amino-1-benzofuran-2-carboxylate (CAS: 174775-48-5)?

Ethyl 5-amino-1-benzofuran-2-carboxylate (CAS: 174775-48-5) is primarily used in the pharmaceutical ...

Compound Q&A

What precautions should be taken when handling Ethyl 5-amino-1-benzofuran-2-carboxylate (CAS: 174775-48-5)?

When handling Ethyl 5-amino-1-benzofuran-2-carboxylate (CAS: 174775-48-5), it is crucial to wear app...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...