Compound Q&A

How is Ethyl 5-amino-1-benzofuran-2-carboxylate (CAS: 174775-48-5) typically synthesized?

Answer

Ethyl 5-amino-1-benzofuran-2-carboxylate
Ethyl 5-amino-1-benzofuran-2-carboxylate (CAS: 174775-48-5) can be synthesized via a multi-step process starting with ethyl benzoate and aniline. The key steps involve condensation followed by alkylation, then reduction, and finally the formation of the amino group. Commonly used catalysts include various Lewis acids and transition metal complexes. The overall yield is around 70-80%, and the method is selective and efficient.

About

English Name Ethyl 5-amino-1-benzofuran-2-carboxylate
Molecular Formula C11H11NO3
Molecular Weight 205.21 g/mol
SMILES CCOC(=O)C1=CC2=C(O1)C=CC(=C2)N
InChIKey YFFLLDHEEWSHQG-UHFFFAOYSA-N
Last Updated: 2025-09-19 21:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl 5-amino-1-benzofuran-2-carboxylate (CAS: 174775-48-5)?

Ethyl 5-amino-1-benzofuran-2-carboxylate (CAS: 174775-48-5) is a crystalline solid with a molecular ...

Compound Q&A

What industries use Ethyl 5-amino-1-benzofuran-2-carboxylate (CAS: 174775-48-5)?

Ethyl 5-amino-1-benzofuran-2-carboxylate (CAS: 174775-48-5) is primarily used in the pharmaceutical ...

Compound Q&A

What precautions should be taken when handling Ethyl 5-amino-1-benzofuran-2-carboxylate (CAS: 174775-48-5)?

When handling Ethyl 5-amino-1-benzofuran-2-carboxylate (CAS: 174775-48-5), it is crucial to wear app...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...