Compound Q&A

What industries use 5-Bromo-4-methyl-3-nitro-2-pyridinamine (CAS: 100367-40-6)?

Answer

5-Bromo-4-methyl-3-nitro-2-pyridinamine
5-Bromo-4-methyl-3-nitro-2-pyridinamine finds applications in the pharmaceutical industry for the synthesis of certain intermediates and in the electronics industry for the production of semiconductors and other materials. It is also used in the development of organic sensors and as a reagent in various chemical processes.

About

English Name 5-Bromo-4-methyl-3-nitro-2-pyridinamine
Molecular Formula C6H6BrN3O2
Molecular Weight 232.03 g/mol
SMILES CC1=C(C(=NC=C1Br)N)[N+](=O)[O-]
InChIKey KFVGEPWMVKZPND-UHFFFAOYSA-N
Last Updated: 2025-09-16 13:49

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-Bromo-4-methyl-3-nitro-2-pyridinamine (CAS: 100367-40-6)?

5-Bromo-4-methyl-3-nitro-2-pyridinamine is a crystalline solid with a molecular weight of approximat...

Compound Q&A

How is 5-Bromo-4-methyl-3-nitro-2-pyridinamine (CAS: 100367-40-6) typically synthesized?

5-Bromo-4-methyl-3-nitro-2-pyridinamine can be synthesized through a multi-step process involving th...

Compound Q&A

What precautions should be taken when handling 5-Bromo-4-methyl-3-nitro-2-pyridinamine (CAS: 100367-40-6)?

When handling 5-Bromo-4-methyl-3-nitro-2-pyridinamine, it is crucial to wear appropriate personal pr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...