Compound Q&A

How is 5-Bromo-4-methyl-3-nitro-2-pyridinamine (CAS: 100367-40-6) typically synthesized?

Answer

5-Bromo-4-methyl-3-nitro-2-pyridinamine
5-Bromo-4-methyl-3-nitro-2-pyridinamine can be synthesized through a multi-step process involving the nitration of 4-methyl-5-nitro-2-pyridinamine followed by bromination. This typically requires the use of concentrated nitric acid and fuming sulfuric acid, with bromination using N-bromosuccinimide (NBS) in the presence of a radical initiator like benzoyl peroxide.

About

English Name 5-Bromo-4-methyl-3-nitro-2-pyridinamine
Molecular Formula C6H6BrN3O2
Molecular Weight 232.03 g/mol
SMILES CC1=C(C(=NC=C1Br)N)[N+](=O)[O-]
InChIKey KFVGEPWMVKZPND-UHFFFAOYSA-N
Last Updated: 2025-09-16 13:49

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-Bromo-4-methyl-3-nitro-2-pyridinamine (CAS: 100367-40-6)?

5-Bromo-4-methyl-3-nitro-2-pyridinamine is a crystalline solid with a molecular weight of approximat...

Compound Q&A

What industries use 5-Bromo-4-methyl-3-nitro-2-pyridinamine (CAS: 100367-40-6)?

5-Bromo-4-methyl-3-nitro-2-pyridinamine finds applications in the pharmaceutical industry for the sy...

Compound Q&A

What precautions should be taken when handling 5-Bromo-4-methyl-3-nitro-2-pyridinamine (CAS: 100367-40-6)?

When handling 5-Bromo-4-methyl-3-nitro-2-pyridinamine, it is crucial to wear appropriate personal pr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...