Compound Q&A

What industries use Methyl 4'-methyl-2-biphenylcarboxylate (CAS: 114772-34-8)?

Answer

Methyl 4'-methyl-2-biphenylcarboxylate
Methyl 4'-methyl-2-biphenylcarboxylate (CAS: 114772-34-8) is used in the pharmaceutical and polymer industries. In pharmaceuticals, it serves as a precursor for the synthesis of certain drugs and intermediates. In polymers, it can be used in the preparation of functional polymers with specific properties. Additionally, it finds applications in the production of sensors and semiconductors due to its chemical stability and reactivity.

About

English Name Methyl 4'-methyl-2-biphenylcarboxylate
Molecular Formula C15H14O2
Molecular Weight 226.27 g/mol
SMILES CC1=CC=C(C=C1)C2=CC=CC=C2C(=O)OC
InChIKey IHNIAWHITVGYJJ-UHFFFAOYSA-N
Last Updated: 2025-09-16 13:49

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 4'-methyl-2-biphenylcarboxylate (CAS: 114772-34-8)?

Methyl 4'-methyl-2-biphenylcarboxylate (CAS: 114772-34-8) is a colorless or pale yellow liquid. It h...

Compound Q&A

How is Methyl 4'-methyl-2-biphenylcarboxylate (CAS: 114772-34-8) typically synthesized?

Methyl 4'-methyl-2-biphenylcarboxylate (CAS: 114772-34-8) is typically synthesized through the react...

Compound Q&A

What precautions should be taken when handling Methyl 4'-methyl-2-biphenylcarboxylate (CAS: 114772-34-8)?

When handling Methyl 4'-methyl-2-biphenylcarboxylate (CAS: 114772-34-8), it is crucial to wear appro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...