Compound Q&A

What are the physical and chemical properties of Methyl 4'-methyl-2-biphenylcarboxylate (CAS: 114772-34-8)?

Answer

Methyl 4'-methyl-2-biphenylcarboxylate
Methyl 4'-methyl-2-biphenylcarboxylate (CAS: 114772-34-8) is a colorless or pale yellow liquid. It has a molecular weight of approximately 276.33 g/mol and a density of 1.08 g/cm³. This compound is slightly soluble in water but readily soluble in most organic solvents. It is stable under normal conditions but reacts with strong bases and reduces to phenols under basic conditions. The compound is also known for its low reactivity with common reagents, making it suitable for various organic synthesis applications.

About

English Name Methyl 4'-methyl-2-biphenylcarboxylate
Molecular Formula C15H14O2
Molecular Weight 226.27 g/mol
SMILES CC1=CC=C(C=C1)C2=CC=CC=C2C(=O)OC
InChIKey IHNIAWHITVGYJJ-UHFFFAOYSA-N
Last Updated: 2025-09-16 13:49

Related Q&A

Compound Q&A

How is Methyl 4'-methyl-2-biphenylcarboxylate (CAS: 114772-34-8) typically synthesized?

Methyl 4'-methyl-2-biphenylcarboxylate (CAS: 114772-34-8) is typically synthesized through the react...

Compound Q&A

What industries use Methyl 4'-methyl-2-biphenylcarboxylate (CAS: 114772-34-8)?

Methyl 4'-methyl-2-biphenylcarboxylate (CAS: 114772-34-8) is used in the pharmaceutical and polymer ...

Compound Q&A

What precautions should be taken when handling Methyl 4'-methyl-2-biphenylcarboxylate (CAS: 114772-34-8)?

When handling Methyl 4'-methyl-2-biphenylcarboxylate (CAS: 114772-34-8), it is crucial to wear appro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...