Compound Q&A

How is Methyl 4'-methyl-2-biphenylcarboxylate (CAS: 114772-34-8) typically synthesized?

Answer

Methyl 4'-methyl-2-biphenylcarboxylate
Methyl 4'-methyl-2-biphenylcarboxylate (CAS: 114772-34-8) is typically synthesized through the reaction of 4'-methyl-2-biphenylcarboxylic acid with methanol in the presence of a catalytic amount of sulfuric acid. The process involves esterification, where the carboxylic acid group reacts with methanol to form the methyl ester. The reaction is carried out at room temperature, and the product is isolated by recrystallization from a suitable solvent. This method provides good yield and selectivity.

About

English Name Methyl 4'-methyl-2-biphenylcarboxylate
Molecular Formula C15H14O2
Molecular Weight 226.27 g/mol
SMILES CC1=CC=C(C=C1)C2=CC=CC=C2C(=O)OC
InChIKey IHNIAWHITVGYJJ-UHFFFAOYSA-N
Last Updated: 2025-09-16 13:49

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 4'-methyl-2-biphenylcarboxylate (CAS: 114772-34-8)?

Methyl 4'-methyl-2-biphenylcarboxylate (CAS: 114772-34-8) is a colorless or pale yellow liquid. It h...

Compound Q&A

What industries use Methyl 4'-methyl-2-biphenylcarboxylate (CAS: 114772-34-8)?

Methyl 4'-methyl-2-biphenylcarboxylate (CAS: 114772-34-8) is used in the pharmaceutical and polymer ...

Compound Q&A

What precautions should be taken when handling Methyl 4'-methyl-2-biphenylcarboxylate (CAS: 114772-34-8)?

When handling Methyl 4'-methyl-2-biphenylcarboxylate (CAS: 114772-34-8), it is crucial to wear appro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...