Compound Q&A

What precautions should be taken when handling 2-(Trifluoromethyl)nicotinic acid (CAS: 131747-43-8)?

Answer

2-(Trifluoromethyl)nicotinic acid
When handling 2-(Trifluoromethyl)nicotinic acid, it is essential to wear appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work should be conducted in a well-ventilated environment or a fume hood. Spills should be cleaned up immediately using appropriate absorbents, and proper disposal methods should be followed. Refer to the Safety Data Sheet (SDS) for specific handling guidelines and emergency procedures.

About

English Name 2-(Trifluoromethyl)nicotinic acid
Molecular Formula C7H4F3NO2
Molecular Weight 191.11 g/mol
SMILES C1=CC(=C(N=C1)C(F)(F)F)C(=O)O
InChIKey BFROETNLEIAWNO-UHFFFAOYSA-N
Last Updated: 2025-09-16 13:49

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-(Trifluoromethyl)nicotinic acid (CAS: 131747-43-8)?

2-(Trifluoromethyl)nicotinic acid is a white crystalline solid with a molecular weight of approximat...

Compound Q&A

How is 2-(Trifluoromethyl)nicotinic acid (CAS: 131747-43-8) typically synthesized?

2-(Trifluoromethyl)nicotinic acid can be synthesized through the trifluoromethylation of nicotinic a...

Compound Q&A

What industries use 2-(Trifluoromethyl)nicotinic acid (CAS: 131747-43-8)?

2-(Trifluoromethyl)nicotinic acid is utilized in various industries, particularly in pharmaceuticals...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...