Compound Q&A

What industries use 2-(Trifluoromethyl)nicotinic acid (CAS: 131747-43-8)?

Answer

2-(Trifluoromethyl)nicotinic acid
2-(Trifluoromethyl)nicotinic acid is utilized in various industries, particularly in pharmaceuticals for its role as a precursor in the synthesis of biologically active compounds. It also finds applications in the preparation of materials for sensors and advanced polymers due to its unique chemical properties.

About

English Name 2-(Trifluoromethyl)nicotinic acid
Molecular Formula C7H4F3NO2
Molecular Weight 191.11 g/mol
SMILES C1=CC(=C(N=C1)C(F)(F)F)C(=O)O
InChIKey BFROETNLEIAWNO-UHFFFAOYSA-N
Last Updated: 2025-09-16 13:49

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-(Trifluoromethyl)nicotinic acid (CAS: 131747-43-8)?

2-(Trifluoromethyl)nicotinic acid is a white crystalline solid with a molecular weight of approximat...

Compound Q&A

How is 2-(Trifluoromethyl)nicotinic acid (CAS: 131747-43-8) typically synthesized?

2-(Trifluoromethyl)nicotinic acid can be synthesized through the trifluoromethylation of nicotinic a...

Compound Q&A

What precautions should be taken when handling 2-(Trifluoromethyl)nicotinic acid (CAS: 131747-43-8)?

When handling 2-(Trifluoromethyl)nicotinic acid, it is essential to wear appropriate personal protec...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...