Compound Q&A

How is 2-(Trifluoromethyl)nicotinic acid (CAS: 131747-43-8) typically synthesized?

Answer

2-(Trifluoromethyl)nicotinic acid
2-(Trifluoromethyl)nicotinic acid can be synthesized through the trifluoromethylation of nicotinic acid using reagents such as triflic anhydride. Common methods include nucleophilic substitution reactions in the presence of appropriate bases. The synthesis typically yields a high percentage of the desired product with good selectivity.

About

English Name 2-(Trifluoromethyl)nicotinic acid
Molecular Formula C7H4F3NO2
Molecular Weight 191.11 g/mol
SMILES C1=CC(=C(N=C1)C(F)(F)F)C(=O)O
InChIKey BFROETNLEIAWNO-UHFFFAOYSA-N
Last Updated: 2025-09-16 13:49

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-(Trifluoromethyl)nicotinic acid (CAS: 131747-43-8)?

2-(Trifluoromethyl)nicotinic acid is a white crystalline solid with a molecular weight of approximat...

Compound Q&A

What industries use 2-(Trifluoromethyl)nicotinic acid (CAS: 131747-43-8)?

2-(Trifluoromethyl)nicotinic acid is utilized in various industries, particularly in pharmaceuticals...

Compound Q&A

What precautions should be taken when handling 2-(Trifluoromethyl)nicotinic acid (CAS: 131747-43-8)?

When handling 2-(Trifluoromethyl)nicotinic acid, it is essential to wear appropriate personal protec...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...