Compound Q&A

What industries use 1,1,5,5-Tetramethyl-3,3-diphenyltrisiloxane (CAS: 17875-55-7)?

Answer

1,1,5,5-Tetramethyl-3,3-diphenyltrisiloxane
1,1,5,5-Tetramethyl-3,3-diphenyltrisiloxane (CAS: 17875-55-7) is used in various industries, including pharmaceuticals, polymers, and sensors. In pharmaceutical applications, it serves as a diluent or solvent. In polymers, it is used to prepare silicone rubbers and adhesives. It also finds application in the production of sensors and semiconductors due to its thermal stability and chemical inertness.

About

CAS No 17875-55-7
English Name 1,1,5,5-Tetramethyl-3,3-diphenyltrisiloxane
Molecular Formula C16H24O2Si3
Molecular Weight 332.62 g/mol
SMILES C[Si](C)O[Si](C1=CC=CC=C1)(C2=CC=CC=C2)O[Si](C)C
InChIKey SBURHUAIGVFSSI-UHFFFAOYSA-N
Last Updated: 2025-09-16 13:49

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1,1,5,5-Tetramethyl-3,3-diphenyltrisiloxane (CAS: 17875-55-7)?

1,1,5,5-Tetramethyl-3,3-diphenyltrisiloxane (CAS: 17875-55-7) is a clear, colorless liquid with a hi...

Compound Q&A

How is 1,1,5,5-Tetramethyl-3,3-diphenyltrisiloxane (CAS: 17875-55-7) typically synthesized?

1,1,5,5-Tetramethyl-3,3-diphenyltrisiloxane (CAS: 17875-55-7) is typically synthesized through the c...

Compound Q&A

What precautions should be taken when handling 1,1,5,5-Tetramethyl-3,3-diphenyltrisiloxane (CAS: 17875-55-7)?

When handling 1,1,5,5-Tetramethyl-3,3-diphenyltrisiloxane (CAS: 17875-55-7), it is important to wear...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...