Compound Q&A

What are the physical and chemical properties of 1,1,5,5-Tetramethyl-3,3-diphenyltrisiloxane (CAS: 17875-55-7)?

Answer

1,1,5,5-Tetramethyl-3,3-diphenyltrisiloxane
1,1,5,5-Tetramethyl-3,3-diphenyltrisiloxane (CAS: 17875-55-7) is a clear, colorless liquid with a high boiling point. It has a high molecular weight and low volatility. The compound is poorly soluble in water but miscible with organic solvents. Chemically, it is relatively inert but can undergo reactions under certain conditions. It has low reactivity but can participate in condensation reactions to form higher polymers.

About

CAS No 17875-55-7
English Name 1,1,5,5-Tetramethyl-3,3-diphenyltrisiloxane
Molecular Formula C16H24O2Si3
Molecular Weight 332.62 g/mol
SMILES C[Si](C)O[Si](C1=CC=CC=C1)(C2=CC=CC=C2)O[Si](C)C
InChIKey SBURHUAIGVFSSI-UHFFFAOYSA-N
Last Updated: 2025-09-16 13:49

Related Q&A

Compound Q&A

How is 1,1,5,5-Tetramethyl-3,3-diphenyltrisiloxane (CAS: 17875-55-7) typically synthesized?

1,1,5,5-Tetramethyl-3,3-diphenyltrisiloxane (CAS: 17875-55-7) is typically synthesized through the c...

Compound Q&A

What industries use 1,1,5,5-Tetramethyl-3,3-diphenyltrisiloxane (CAS: 17875-55-7)?

1,1,5,5-Tetramethyl-3,3-diphenyltrisiloxane (CAS: 17875-55-7) is used in various industries, includi...

Compound Q&A

What precautions should be taken when handling 1,1,5,5-Tetramethyl-3,3-diphenyltrisiloxane (CAS: 17875-55-7)?

When handling 1,1,5,5-Tetramethyl-3,3-diphenyltrisiloxane (CAS: 17875-55-7), it is important to wear...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...