Compound Q&A

How is 1,1,5,5-Tetramethyl-3,3-diphenyltrisiloxane (CAS: 17875-55-7) typically synthesized?

Answer

1,1,5,5-Tetramethyl-3,3-diphenyltrisiloxane
1,1,5,5-Tetramethyl-3,3-diphenyltrisiloxane (CAS: 17875-55-7) is typically synthesized through the condensation of diphenylsilane and tetramethyldisiloxane. The reaction is catalyzed by metal salts, and the process is carried out under anhydrous and inert atmosphere conditions to ensure optimal yield and selectivity. The reaction involves the removal of water as a byproduct.

About

CAS No 17875-55-7
English Name 1,1,5,5-Tetramethyl-3,3-diphenyltrisiloxane
Molecular Formula C16H24O2Si3
Molecular Weight 332.62 g/mol
SMILES C[Si](C)O[Si](C1=CC=CC=C1)(C2=CC=CC=C2)O[Si](C)C
InChIKey SBURHUAIGVFSSI-UHFFFAOYSA-N
Last Updated: 2025-09-16 13:49

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1,1,5,5-Tetramethyl-3,3-diphenyltrisiloxane (CAS: 17875-55-7)?

1,1,5,5-Tetramethyl-3,3-diphenyltrisiloxane (CAS: 17875-55-7) is a clear, colorless liquid with a hi...

Compound Q&A

What industries use 1,1,5,5-Tetramethyl-3,3-diphenyltrisiloxane (CAS: 17875-55-7)?

1,1,5,5-Tetramethyl-3,3-diphenyltrisiloxane (CAS: 17875-55-7) is used in various industries, includi...

Compound Q&A

What precautions should be taken when handling 1,1,5,5-Tetramethyl-3,3-diphenyltrisiloxane (CAS: 17875-55-7)?

When handling 1,1,5,5-Tetramethyl-3,3-diphenyltrisiloxane (CAS: 17875-55-7), it is important to wear...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...