Compound Q&A

What precautions should be taken when handling Alisol B (CAS: 18649-93-9)?

Answer

Alisol B
When handling Alisol B (CAS: 18649-93-9), it is important to use personal protective equipment (PPE) such as gloves and safety glasses. Ensure that the work is conducted in a well-ventilated area or a fume hood to prevent inhalation. In case of a spill, immediately clean up using appropriate absorbent materials and follow standard laboratory safety protocols. Always refer to the Safety Data Sheet (SDS) for detailed handling and emergency procedures.

About

CAS No 18649-93-9
English Name Alisol B
Molecular Formula C30H48O4
Molecular Weight 472.7 g/mol
SMILES CC(CC(C1C(O1)(C)C)O)C2=C3CC(C4C5(CCC(=O)C(C5CCC4(C3(CC2)C)C)(C)C)C)O
InChIKey GBJKHDVRXAVITG-UNPOXIGHSA-N
Last Updated: 2025-09-16 13:49

Related Q&A

Compound Q&A

What are the physical and chemical properties of Alisol B (CAS: 18649-93-9)?

Alisol B (CAS: 18649-93-9) is a crystalline compound with a molecular weight of approximately 316.4 ...

Compound Q&A

How is Alisol B (CAS: 18649-93-9) typically synthesized?

Alisol B (CAS: 18649-93-9) is typically synthesized through a series of reactions involving condensa...

Compound Q&A

What industries use Alisol B (CAS: 18649-93-9)?

Alisol B (CAS: 18649-93-9) is used in the pharmaceutical industry for the development of medications...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...