Compound Q&A

How is Alisol B (CAS: 18649-93-9) typically synthesized?

Answer

Alisol B
Alisol B (CAS: 18649-93-9) is typically synthesized through a series of reactions involving condensation and hydrogenation of appropriate precursors. Common starting materials include various triterpenoid derivatives. The synthesis often requires the use of catalysts such as palladium and requires precise control over reaction conditions to achieve high selectivity and yield.

About

CAS No 18649-93-9
English Name Alisol B
Molecular Formula C30H48O4
Molecular Weight 472.7 g/mol
SMILES CC(CC(C1C(O1)(C)C)O)C2=C3CC(C4C5(CCC(=O)C(C5CCC4(C3(CC2)C)C)(C)C)C)O
InChIKey GBJKHDVRXAVITG-UNPOXIGHSA-N
Last Updated: 2025-09-16 13:49

Related Q&A

Compound Q&A

What are the physical and chemical properties of Alisol B (CAS: 18649-93-9)?

Alisol B (CAS: 18649-93-9) is a crystalline compound with a molecular weight of approximately 316.4 ...

Compound Q&A

What industries use Alisol B (CAS: 18649-93-9)?

Alisol B (CAS: 18649-93-9) is used in the pharmaceutical industry for the development of medications...

Compound Q&A

What precautions should be taken when handling Alisol B (CAS: 18649-93-9)?

When handling Alisol B (CAS: 18649-93-9), it is important to use personal protective equipment (PPE)...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...