Compound Q&A

What industries use Alisol B (CAS: 18649-93-9)?

Answer

Alisol B
Alisol B (CAS: 18649-93-9) is used in the pharmaceutical industry for the development of medications, particularly in the area of anti-inflammatory and antiviral drugs. It is also utilized in the cosmetic industry for its potential skin-protective and anti-aging properties. Additionally, it is explored in the polymer industry for its potential to enhance material properties.

About

CAS No 18649-93-9
English Name Alisol B
Molecular Formula C30H48O4
Molecular Weight 472.7 g/mol
SMILES CC(CC(C1C(O1)(C)C)O)C2=C3CC(C4C5(CCC(=O)C(C5CCC4(C3(CC2)C)C)(C)C)C)O
InChIKey GBJKHDVRXAVITG-UNPOXIGHSA-N
Last Updated: 2025-09-16 13:49

Related Q&A

Compound Q&A

What are the physical and chemical properties of Alisol B (CAS: 18649-93-9)?

Alisol B (CAS: 18649-93-9) is a crystalline compound with a molecular weight of approximately 316.4 ...

Compound Q&A

How is Alisol B (CAS: 18649-93-9) typically synthesized?

Alisol B (CAS: 18649-93-9) is typically synthesized through a series of reactions involving condensa...

Compound Q&A

What precautions should be taken when handling Alisol B (CAS: 18649-93-9)?

When handling Alisol B (CAS: 18649-93-9), it is important to use personal protective equipment (PPE)...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...