Compound Q&A

What industries use Tris[3-bromo-2,2-bis(bromomethyl)propyl] phosphate (CAS: 19186-97-1)?

Answer

Tris[3-bromo-2,2-bis(bromomethyl)propyl] phosphate
Tris[3-bromo-2,2-bis(bromomethyl)propyl] phosphate (CAS: 19186-97-1) is widely used in the polymer industry as a flame retardant. It is also employed in the production of pharmaceuticals, where its reactive bromine groups can be utilized in covalent bonding. Additionally, it finds applications in the development of sensors and semiconductors, particularly in photolithography processes.

About

CAS No 19186-97-1
English Name Tris[3-bromo-2,2-bis(bromomethyl)propyl] phosphate
Molecular Formula C15H24Br9O4P
Molecular Weight 1018.46 g/mol
SMILES C(C(CBr)(CBr)CBr)OP(=O)(OCC(CBr)(CBr)CBr)OCC(CBr)(CBr)CBr
InChIKey BHYQWBKCXBXPKM-UHFFFAOYSA-N
Last Updated: 2025-09-16 13:49

Related Q&A

Compound Q&A

What are the physical and chemical properties of Tris[3-bromo-2,2-bis(bromomethyl)propyl] phosphate (CAS: 19186-97-1)?

Tris[3-bromo-2,2-bis(bromomethyl)propyl] phosphate (CAS: 19186-97-1) is a colorless to slightly yell...

Compound Q&A

How is Tris[3-bromo-2,2-bis(bromomethyl)propyl] phosphate (CAS: 19186-97-1) typically synthesized?

Tris[3-bromo-2,2-bis(bromomethyl)propyl] phosphate is typically synthesized through a series of reac...

Compound Q&A

What precautions should be taken when handling Tris[3-bromo-2,2-bis(bromomethyl)propyl] phosphate (CAS: 19186-97-1)?

When handling Tris[3-bromo-2,2-bis(bromomethyl)propyl] phosphate (CAS: 19186-97-1), it is essential ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...